C29H35ClN6O2 — CID 136930164
3-[4-(3-chlorophenyl)-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-6-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136930164) has the molecular formula C29H35ClN6O2 and a molecular weight of 535.09 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-6-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[4-(3-chlorophenyl)-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-6-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136930164 |
| Molecular Formula | C29H35ClN6O2 |
| Molecular Weight | 535.09 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 3-[4-(3-chlorophenyl)-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-6-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CC1CCC(Cn2c(N3[C@H](C)CCC[C@H]3C)nc3cc(-c4noc(=O)[nH]4)nc(-c4cccc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C29H35ClN6O2/c1-17-10-12-20(13-11-17)16-35-26-23(32-28(35)36-18(2)6-4-7-19(36)3)15-24(27-33-29(37)38-34-27)31-25(26)21-8-5-9-22(30)14-21/h5,8-9,14-15,17-20H,4,6-7,10-13,16H2,1-3H3,(H,33,34,37)/t17?,18-,19-,20?/m1/s1 |
| InChIKey | PSRASNTVZXDWDA-WBFXSEPVSA-N |
| XLogP | 6.69 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.09 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |