C30H30Cl2N8O3 — CID 136632506
3-[6-(2,6-dichloro-4-pyridinyl)-7-[(4-methylcyclohexyl)methyl]-8-(3-phenylmorpholin-4-yl)purin-2-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136632506) has the molecular formula C30H30Cl2N8O3 and a molecular weight of 621.53 g/mol. Its IUPAC name is 3-[6-(2,6-dichloro-4-pyridinyl)-7-[(4-methylcyclohexyl)methyl]-8-(3-phenylmorpholin-4-yl)purin-2-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[6-(2,6-dichloro-4-pyridinyl)-7-[(4-methylcyclohexyl)methyl]-8-(3-phenylmorpholin-4-yl)purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136632506 |
| Molecular Formula | C30H30Cl2N8O3 |
| Molecular Weight | 621.53 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | 3-[6-(2,6-dichloro-4-pyridinyl)-7-[(4-methylcyclohexyl)methyl]-8-(3-phenylmorpholin-4-yl)purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CC1CCC(Cn2c(N3CCOCC3c3ccccc3)nc3nc(-c4noc(=O)[nH]4)nc(-c4cc(Cl)nc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C30H30Cl2N8O3/c1-17-7-9-18(10-8-17)15-40-25-24(20-13-22(31)33-23(32)14-20)34-27(28-37-30(41)43-38-28)35-26(25)36-29(40)39-11-12-42-16-21(39)19-5-3-2-4-6-19/h2-6,13-14,17-18,21H,7-12,15-16H2,1H3,(H,37,38,41) |
| InChIKey | QUFJEQKVDAQSNV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|