C24H28Cl2N4O — CID 123411495
4-[4,6-dichloro-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-phenylmorpholine (PubChem CID 123411495) has the molecular formula C24H28Cl2N4O and a molecular weight of 459.42 g/mol. Its IUPAC name is 4-[4,6-dichloro-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-phenylmorpholine.
| Compound Name | 4-[4,6-dichloro-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-phenylmorpholine |
|---|---|
| PubChem CID | 123411495 |
| Molecular Formula | C24H28Cl2N4O |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 4-[4,6-dichloro-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-phenylmorpholine |
| SMILES | CC1CCC(Cn2c(N3CCOCC3c3ccccc3)nc3cc(Cl)nc(Cl)c32)CC1 |
| InChI | InChI=1S/C24H28Cl2N4O/c1-16-7-9-17(10-8-16)14-30-22-19(13-21(25)28-23(22)26)27-24(30)29-11-12-31-15-20(29)18-5-3-2-4-6-18/h2-6,13,16-17,20H,7-12,14-15H2,1H3 |
| InChIKey | YVFYEUVXEWRKBF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|