C30H39ClN4O2 — CID 123319704
4-[6-chloro-4-(1-cyclobutylethoxy)-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-phenylmorpholine (PubChem CID 123319704) has the molecular formula C30H39ClN4O2 and a molecular weight of 523.12 g/mol. Its IUPAC name is 4-[6-chloro-4-(1-cyclobutylethoxy)-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-phenylmorpholine.
| Compound Name | 4-[6-chloro-4-(1-cyclobutylethoxy)-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-phenylmorpholine |
|---|---|
| PubChem CID | 123319704 |
| Molecular Formula | C30H39ClN4O2 |
| Molecular Weight | 523.12 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 4-[6-chloro-4-(1-cyclobutylethoxy)-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridin-2-yl]-3-phenylmorpholine |
| SMILES | CC1CCC(Cn2c(N3CCOCC3c3ccccc3)nc3cc(Cl)nc(OC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C30H39ClN4O2/c1-20-11-13-22(14-12-20)18-35-28-25(17-27(31)33-29(28)37-21(2)23-9-6-10-23)32-30(35)34-15-16-36-19-26(34)24-7-4-3-5-8-24/h3-5,7-8,17,20-23,26H,6,9-16,18-19H2,1-2H3 |
| InChIKey | DJWOBIFFOYZFES-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.12 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|