C31H34ClN7O3 — CID 144678495
(Z)-[amino-[6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]methylidene]carbamic acid (PubChem CID 144678495) has the molecular formula C31H34ClN7O3 and a molecular weight of 588.11 g/mol. Its IUPAC name is (Z)-[amino-[6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 144678495 |
| Molecular Formula | C31H34ClN7O3 |
| Molecular Weight | 588.11 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | (Z)-[amino-[6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]methylidene]carbamic acid |
| SMILES | CC1CCC(Cn2c(N3CCOC[C@H]3c3ccccc3)nc3nc(/C(N)=N/C(=O)O)nc(-c4cccc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C31H34ClN7O3/c1-19-10-12-20(13-11-19)17-39-26-25(22-8-5-9-23(32)16-22)34-29(27(33)35-31(40)41)36-28(26)37-30(39)38-14-15-42-18-24(38)21-6-3-2-4-7-21/h2-9,16,19-20,24H,10-15,17-18H2,1H3,(H2,33,35)(H,40,41)/t19?,20?,24-/m0/s1 |
| InChIKey | FEQOAMXQPDXASG-IMQCZEGASA-N |
| XLogP | 5.93 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.11 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|