C33H33F2N7O3 — CID 134467720
(Z)-[amino-[6-[3-(difluoromethyl)phenyl]-7-[(4-ethynylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]methylidene]carbamic acid (PubChem CID 134467720) has the molecular formula C33H33F2N7O3 and a molecular weight of 613.67 g/mol. Its IUPAC name is (Z)-[amino-[6-[3-(difluoromethyl)phenyl]-7-[(4-ethynylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[6-[3-(difluoromethyl)phenyl]-7-[(4-ethynylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 134467720 |
| Molecular Formula | C33H33F2N7O3 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | (Z)-[amino-[6-[3-(difluoromethyl)phenyl]-7-[(4-ethynylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]methylidene]carbamic acid |
| SMILES | C#CC1CCC(Cn2c(N3CCOC[C@H]3c3ccccc3)nc3nc(/C(N)=N/C(=O)O)nc(-c4cccc(C(F)F)c4)c32)CC1 |
| InChI | InChI=1S/C33H33F2N7O3/c1-2-20-11-13-21(14-12-20)18-42-27-26(23-9-6-10-24(17-23)28(34)35)37-31(29(36)38-33(43)44)39-30(27)40-32(42)41-15-16-45-19-25(41)22-7-4-3-5-8-22/h1,3-10,17,20-21,25,28H,11-16,18-19H2,(H2,36,38)(H,43,44)/t20?,21?,25-/m0/s1 |
| InChIKey | WVCDVAUJEKYKPD-BAWHURIHSA-N |
| XLogP | 5.83 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|