C29H36ClN7O3 — CID 123558390
[amino-[6-(3-chlorophenyl)-8-(3-ethylmorpholin-4-yl)-7-(6-methylnon-8-yn-2-yl)purin-2-yl]methylidene]carbamic acid (PubChem CID 123558390) has the molecular formula C29H36ClN7O3 and a molecular weight of 566.11 g/mol. Its IUPAC name is [amino-[6-(3-chlorophenyl)-8-(3-ethylmorpholin-4-yl)-7-(6-methylnon-8-yn-2-yl)purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(3-chlorophenyl)-8-(3-ethylmorpholin-4-yl)-7-(6-methylnon-8-yn-2-yl)purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123558390 |
| Molecular Formula | C29H36ClN7O3 |
| Molecular Weight | 566.11 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | [amino-[6-(3-chlorophenyl)-8-(3-ethylmorpholin-4-yl)-7-(6-methylnon-8-yn-2-yl)purin-2-yl]methylidene]carbamic acid |
| SMILES | C#CCC(C)CCCC(C)n1c(N2CCOCC2CC)nc2nc(C(N)=NC(=O)O)nc(-c3cccc(Cl)c3)c21 |
| InChI | InChI=1S/C29H36ClN7O3/c1-5-9-18(3)10-7-11-19(4)37-24-23(20-12-8-13-21(30)16-20)32-27(25(31)33-29(38)39)34-26(24)35-28(37)36-14-15-40-17-22(36)6-2/h1,8,12-13,16,18-19,22H,6-7,9-11,14-15,17H2,2-4H3,(H2,31,33)(H,38,39) |
| InChIKey | CCYDBMZVGZEXOS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.11 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|