C26H28ClN7O3 — CID 123139156
carbamoyl 6-(3-chlorophenyl)-7-[(4-ethynylcyclohexyl)methyl]-8-morpholin-4-ylpurine-2-carboximidate (PubChem CID 123139156) has the molecular formula C26H28ClN7O3 and a molecular weight of 522.01 g/mol. Its IUPAC name is carbamoyl 6-(3-chlorophenyl)-7-[(4-ethynylcyclohexyl)methyl]-8-morpholin-4-ylpurine-2-carboximidate.
| Compound Name | carbamoyl 6-(3-chlorophenyl)-7-[(4-ethynylcyclohexyl)methyl]-8-morpholin-4-ylpurine-2-carboximidate |
|---|---|
| PubChem CID | 123139156 |
| Molecular Formula | C26H28ClN7O3 |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | carbamoyl 6-(3-chlorophenyl)-7-[(4-ethynylcyclohexyl)methyl]-8-morpholin-4-ylpurine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(-c2cccc(Cl)c2)c2c(n1)nc(N1CCOCC1)n2CC1CCC(C#C)CC1 |
| InChI | InChI=1S/C26H28ClN7O3/c1-2-16-6-8-17(9-7-16)15-34-21-20(18-4-3-5-19(27)14-18)30-24(22(28)37-25(29)35)31-23(21)32-26(34)33-10-12-36-13-11-33/h1,3-5,14,16-17,28H,6-13,15H2,(H2,29,35)/b28-22- |
| InChIKey | BZZUKARLOJCWIZ-SLMZUGIISA-N |
| XLogP | 3.84 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|