C25H37N7O3 — CID 144678392
carbamoyl 6-cyclohexyl-7-[(4-methylcyclohexyl)methyl]-8-morpholin-4-ylpurine-2-carboximidate (PubChem CID 144678392) has the molecular formula C25H37N7O3 and a molecular weight of 483.62 g/mol. Its IUPAC name is carbamoyl 6-cyclohexyl-7-[(4-methylcyclohexyl)methyl]-8-morpholin-4-ylpurine-2-carboximidate.
| Compound Name | carbamoyl 6-cyclohexyl-7-[(4-methylcyclohexyl)methyl]-8-morpholin-4-ylpurine-2-carboximidate |
|---|---|
| PubChem CID | 144678392 |
| Molecular Formula | C25H37N7O3 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | carbamoyl 6-cyclohexyl-7-[(4-methylcyclohexyl)methyl]-8-morpholin-4-ylpurine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(C2CCCCC2)c2c(n1)nc(N1CCOCC1)n2CC1CCC(C)CC1 |
| InChI | InChI=1S/C25H37N7O3/c1-16-7-9-17(10-8-16)15-32-20-19(18-5-3-2-4-6-18)28-23(21(26)35-24(27)33)29-22(20)30-25(32)31-11-13-34-14-12-31/h16-18,26H,2-15H2,1H3,(H2,27,33)/b26-21- |
| InChIKey | VEUSHJWTSAIVOS-QLYXXIJNSA-N |
| XLogP | 3.96 |
| TPSA | 132.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|