C29H33ClFN7O2 — CID 134468685
carbamoyl 6-[2-[(1E)-2-chlorobuta-1,3-dienyl]iminoethyl]-8-[1-(2-fluorophenyl)ethyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidate (PubChem CID 134468685) has the molecular formula C29H33ClFN7O2 and a molecular weight of 566.08 g/mol. Its IUPAC name is carbamoyl 6-[2-[(1E)-2-chlorobuta-1,3-dienyl]iminoethyl]-8-[1-(2-fluorophenyl)ethyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidate.
| Compound Name | carbamoyl 6-[2-[(1E)-2-chlorobuta-1,3-dienyl]iminoethyl]-8-[1-(2-fluorophenyl)ethyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidate |
|---|---|
| PubChem CID | 134468685 |
| Molecular Formula | C29H33ClFN7O2 |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | carbamoyl 6-[2-[(1E)-2-chlorobuta-1,3-dienyl]iminoethyl]-8-[1-(2-fluorophenyl)ethyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(C/C=N/C=C(/Cl)C=C)c2c(n1)nc(C(C)c1ccccc1F)n2CC1CCC(C)CC1 |
| InChI | InChI=1S/C29H33ClFN7O2/c1-4-20(30)15-34-14-13-23-24-26(36-27(35-23)25(32)40-29(33)39)37-28(18(3)21-7-5-6-8-22(21)31)38(24)16-19-11-9-17(2)10-12-19/h4-8,14-15,17-19,32H,1,9-13,16H2,2-3H3,(H2,33,39)/b20-15+,32-25-,34-14+ |
| InChIKey | VJYLMQYKDVOOIU-WSRQPPTDSA-N |
| XLogP | 6.24 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|