C30H39ClN8O4 — CID 134468275
carbamoyl 6-(5-chloro-2-oxo-1H-pyridin-3-yl)-8-[(3R)-3-[(Z)-hex-4-enyl]morpholin-4-yl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidate (PubChem CID 134468275) has the molecular formula C30H39ClN8O4 and a molecular weight of 611.15 g/mol. Its IUPAC name is carbamoyl 6-(5-chloro-2-oxo-1H-pyridin-3-yl)-8-[(3R)-3-[(Z)-hex-4-enyl]morpholin-4-yl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidate.
| Compound Name | carbamoyl 6-(5-chloro-2-oxo-1H-pyridin-3-yl)-8-[(3R)-3-[(Z)-hex-4-enyl]morpholin-4-yl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidate |
|---|---|
| PubChem CID | 134468275 |
| Molecular Formula | C30H39ClN8O4 |
| Molecular Weight | 611.15 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | carbamoyl 6-(5-chloro-2-oxo-1H-pyridin-3-yl)-8-[(3R)-3-[(Z)-hex-4-enyl]morpholin-4-yl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(-c2cc(Cl)c[nH]c2=O)c2c(n1)nc(N1CCOC[C@H]1CCC/C=C\C)n2CC1CCC(C)CC1 |
| InChI | InChI=1S/C30H39ClN8O4/c1-3-4-5-6-7-21-17-42-13-12-38(21)30-37-26-24(39(30)16-19-10-8-18(2)9-11-19)23(22-14-20(31)15-34-28(22)40)35-27(36-26)25(32)43-29(33)41/h3-4,14-15,18-19,21,32H,5-13,16-17H2,1-2H3,(H2,33,41)(H,34,40)/b4-3-,32-25-/t18?,19?,21-/m1/s1 |
| InChIKey | LOBMFHYXHAJGLD-ZVZDOQSWSA-N |
| XLogP | 5.03 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.15 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|