C34H40N8O3 — CID 134467801
carbamoyl 6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-ethynylcyclohexyl)methyl]-8-[(2S,3R)-2-ethynyl-3-phenylmorpholin-4-yl]purine-2-carboximidate (PubChem CID 134467801) has the molecular formula C34H40N8O3 and a molecular weight of 608.75 g/mol. Its IUPAC name is carbamoyl 6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-ethynylcyclohexyl)methyl]-8-[(2S,3R)-2-ethynyl-3-phenylmorpholin-4-yl]purine-2-carboximidate.
| Compound Name | carbamoyl 6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-ethynylcyclohexyl)methyl]-8-[(2S,3R)-2-ethynyl-3-phenylmorpholin-4-yl]purine-2-carboximidate |
|---|---|
| PubChem CID | 134467801 |
| Molecular Formula | C34H40N8O3 |
| Molecular Weight | 608.75 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | carbamoyl 6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-ethynylcyclohexyl)methyl]-8-[(2S,3R)-2-ethynyl-3-phenylmorpholin-4-yl]purine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(N[C@H](C)C2CCC2)c2c(n1)nc(N1CCO[C@@H](C#C)[C@H]1c1ccccc1)n2CC1CCC(C#C)CC1 |
| InChI | InChI=1S/C34H40N8O3/c1-4-22-14-16-23(17-15-22)20-42-28-30(37-21(3)24-12-9-13-24)38-32(29(35)45-33(36)43)39-31(28)40-34(42)41-18-19-44-26(5-2)27(41)25-10-7-6-8-11-25/h1-2,6-8,10-11,21-24,26-27,35H,9,12-20H2,3H3,(H2,36,43)(H,37,38,39)/b35-29-/t21-,22?,23?,26+,27-/m1/s1 |
| InChIKey | SOIRMFSVGSYUED-YQPVDMIUSA-N |
| XLogP | 4.87 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|