C30H37N7O3 — CID 123729753
[amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-(1-hydroxy-1-phenylethyl)purin-2-yl]methylidene]carbamic acid (PubChem CID 123729753) has the molecular formula C30H37N7O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-(1-hydroxy-1-phenylethyl)purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-(1-hydroxy-1-phenylethyl)purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123729753 |
| Molecular Formula | C30H37N7O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-(1-hydroxy-1-phenylethyl)purin-2-yl]methylidene]carbamic acid |
| SMILES | C#CC1CCC(Cn2c(C(C)(O)c3ccccc3)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C30H37N7O3/c1-4-19-13-15-20(16-14-19)17-37-23-25(32-18(2)21-9-8-10-21)34-27(24(31)33-29(38)39)35-26(23)36-28(37)30(3,40)22-11-6-5-7-12-22/h1,5-7,11-12,18-21,40H,8-10,13-17H2,2-3H3,(H2,31,33)(H,38,39)(H,32,34,35) |
| InChIKey | MRSBOCYPPVJEPN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 151.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|