C30H39N7O4 — CID 123849195
[amino-[6-(1-cyclobutylethylamino)-8-(1,2-dihydroxy-1-phenylethyl)-7-[(4-ethenylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid (PubChem CID 123849195) has the molecular formula C30H39N7O4 and a molecular weight of 561.69 g/mol. Its IUPAC name is [amino-[6-(1-cyclobutylethylamino)-8-(1,2-dihydroxy-1-phenylethyl)-7-[(4-ethenylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(1-cyclobutylethylamino)-8-(1,2-dihydroxy-1-phenylethyl)-7-[(4-ethenylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123849195 |
| Molecular Formula | C30H39N7O4 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | [amino-[6-(1-cyclobutylethylamino)-8-(1,2-dihydroxy-1-phenylethyl)-7-[(4-ethenylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
| SMILES | C=CC1CCC(Cn2c(C(O)(CO)c3ccccc3)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C30H39N7O4/c1-3-19-12-14-20(15-13-19)16-37-23-25(32-18(2)21-8-7-9-21)34-27(24(31)33-29(39)40)35-26(23)36-28(37)30(41,17-38)22-10-5-4-6-11-22/h3-6,10-11,18-21,38,41H,1,7-9,12-17H2,2H3,(H2,31,33)(H,39,40)(H,32,34,35) |
| InChIKey | IFLBWTOQMKKTNB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 171.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|