C28H39N7O2 — CID 137182945
6-[[(1R)-1-cyclobutylethyl]amino]-N'-hydroxy-8-[methoxy(phenyl)methyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidamide (PubChem CID 137182945) has the molecular formula C28H39N7O2 and a molecular weight of 505.67 g/mol. Its IUPAC name is 6-[[(1R)-1-cyclobutylethyl]amino]-N'-hydroxy-8-[methoxy(phenyl)methyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidamide.
| Compound Name | 6-[[(1R)-1-cyclobutylethyl]amino]-N'-hydroxy-8-[methoxy(phenyl)methyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidamide |
|---|---|
| PubChem CID | 137182945 |
| Molecular Formula | C28H39N7O2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 6-[[(1R)-1-cyclobutylethyl]amino]-N'-hydroxy-8-[methoxy(phenyl)methyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidamide |
| SMILES | COC(c1ccccc1)c1nc2nc(C(N)=NO)nc(N[C@H](C)C3CCC3)c2n1CC1CCC(C)CC1 |
| InChI | InChI=1S/C28H39N7O2/c1-17-12-14-19(15-13-17)16-35-22-25(30-18(2)20-10-7-11-20)31-27(24(29)34-36)32-26(22)33-28(35)23(37-3)21-8-5-4-6-9-21/h4-6,8-9,17-20,23,36H,7,10-16H2,1-3H3,(H2,29,34)(H,30,31,32)/t17?,18-,19?,23?/m1/s1 |
| InChIKey | DFBGPPMZJNORPU-DNCYMHDXSA-N |
| XLogP | 5.08 |
| TPSA | 123.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|