C29H39N7O2 — CID 123357554
[amino-[6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]-8-(2-phenylethyl)purin-2-yl]methylidene]carbamic acid (PubChem CID 123357554) has the molecular formula C29H39N7O2 and a molecular weight of 517.68 g/mol. Its IUPAC name is [amino-[6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]-8-(2-phenylethyl)purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]-8-(2-phenylethyl)purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123357554 |
| Molecular Formula | C29H39N7O2 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]-8-(2-phenylethyl)purin-2-yl]methylidene]carbamic acid |
| SMILES | CC1CCC(Cn2c(CCc3ccccc3)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C29H39N7O2/c1-18-11-13-21(14-12-18)17-36-23(16-15-20-7-4-3-5-8-20)32-27-24(36)26(31-19(2)22-9-6-10-22)34-28(35-27)25(30)33-29(37)38/h3-5,7-8,18-19,21-22H,6,9-17H2,1-2H3,(H2,30,33)(H,37,38)(H,31,34,35) |
| InChIKey | BKXDFRHJNFIIIN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|