C29H35N7O3 — CID 134468707
(Z)-[amino-[8-benzoyl-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-ethenylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid (PubChem CID 134468707) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is (Z)-[amino-[8-benzoyl-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-ethenylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[8-benzoyl-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-ethenylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 134468707 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (Z)-[amino-[8-benzoyl-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-ethenylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
| SMILES | C=CC1CCC(Cn2c(C(=O)c3ccccc3)nc3nc(/C(N)=N/C(=O)O)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C29H35N7O3/c1-3-18-12-14-19(15-13-18)16-36-22-25(31-17(2)20-10-7-11-20)33-27(24(30)32-29(38)39)34-26(22)35-28(36)23(37)21-8-5-4-6-9-21/h3-6,8-9,17-20H,1,7,10-16H2,2H3,(H2,30,32)(H,38,39)(H,31,33,34)/t17-,18?,19?/m1/s1 |
| InChIKey | PMJWGFOPEGFPIQ-LMDPOFIKSA-N |
| XLogP | 5.03 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|