C29H43N7O4 — CID 123342803
[amino-[6-(1-cyclobutylethylamino)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-hydroxy-1-(oxan-4-yl)ethyl]purin-2-yl]methylidene]carbamic acid (PubChem CID 123342803) has the molecular formula C29H43N7O4 and a molecular weight of 553.71 g/mol. Its IUPAC name is [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-hydroxy-1-(oxan-4-yl)ethyl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-hydroxy-1-(oxan-4-yl)ethyl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123342803 |
| Molecular Formula | C29H43N7O4 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-hydroxy-1-(oxan-4-yl)ethyl]purin-2-yl]methylidene]carbamic acid |
| SMILES | C=CC1CCC(Cn2c(C(C)(O)C3CCOCC3)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C29H43N7O4/c1-4-18-8-10-19(11-9-18)16-36-22-24(31-17(2)20-6-5-7-20)33-26(23(30)32-28(37)38)34-25(22)35-27(36)29(3,39)21-12-14-40-15-13-21/h4,17-21,39H,1,5-16H2,2-3H3,(H2,30,32)(H,37,38)(H,31,33,34) |
| InChIKey | RPBKAXAMMWTSPO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 160.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|