C20H33N7O2 — CID 134467578
(Z)-[amino-[4-amino-6-[[(1R)-1-cyclobutylethyl]amino]-5-[(4-methylcyclohexyl)methylamino]pyrimidin-2-yl]methylidene]carbamic acid (PubChem CID 134467578) has the molecular formula C20H33N7O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (Z)-[amino-[4-amino-6-[[(1R)-1-cyclobutylethyl]amino]-5-[(4-methylcyclohexyl)methylamino]pyrimidin-2-yl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[4-amino-6-[[(1R)-1-cyclobutylethyl]amino]-5-[(4-methylcyclohexyl)methylamino]pyrimidin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 134467578 |
| Molecular Formula | C20H33N7O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (Z)-[amino-[4-amino-6-[[(1R)-1-cyclobutylethyl]amino]-5-[(4-methylcyclohexyl)methylamino]pyrimidin-2-yl]methylidene]carbamic acid |
| SMILES | CC1CCC(CNc2c(N)nc(/C(N)=N/C(=O)O)nc2N[C@H](C)C2CCC2)CC1 |
| InChI | InChI=1S/C20H33N7O2/c1-11-6-8-13(9-7-11)10-23-15-16(21)25-19(17(22)26-20(28)29)27-18(15)24-12(2)14-4-3-5-14/h11-14,23H,3-10H2,1-2H3,(H2,22,26)(H,28,29)(H3,21,24,25,27)/t11?,12-,13?/m1/s1 |
| InChIKey | RGSZIQYPCWCZLF-OTTFEQOBSA-N |
| XLogP | 3.28 |
| TPSA | 151.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|