C19H24F3N7O — CID 137283678
4-amino-6-(1-cyclobutylethylamino)-N'-hydroxy-5-[[4-(trifluoromethyl)phenyl]methylamino]pyrimidine-2-carboximidamide (PubChem CID 137283678) has the molecular formula C19H24F3N7O and a molecular weight of 423.44 g/mol. Its IUPAC name is 4-amino-6-(1-cyclobutylethylamino)-N'-hydroxy-5-[[4-(trifluoromethyl)phenyl]methylamino]pyrimidine-2-carboximidamide.
| Compound Name | 4-amino-6-(1-cyclobutylethylamino)-N'-hydroxy-5-[[4-(trifluoromethyl)phenyl]methylamino]pyrimidine-2-carboximidamide |
|---|---|
| PubChem CID | 137283678 |
| Molecular Formula | C19H24F3N7O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 4-amino-6-(1-cyclobutylethylamino)-N'-hydroxy-5-[[4-(trifluoromethyl)phenyl]methylamino]pyrimidine-2-carboximidamide |
| SMILES | CC(Nc1nc(/C(N)=N/O)nc(N)c1NCc1ccc(C(F)(F)F)cc1)C1CCC1 |
| InChI | InChI=1S/C19H24F3N7O/c1-10(12-3-2-4-12)26-17-14(15(23)27-18(28-17)16(24)29-30)25-9-11-5-7-13(8-6-11)19(20,21)22/h5-8,10,12,25,30H,2-4,9H2,1H3,(H2,24,29)(H3,23,26,27,28) |
| InChIKey | QLQIZPXGZRHPCV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|