C27H39FN8O — CID 144677954
4-[[(1R)-1-cyclobutylethyl]amino]-5-[[cyclohexyl(methyl)amino]methyl-[(4-fluorophenyl)methyl]amino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide (PubChem CID 144677954) has the molecular formula C27H39FN8O and a molecular weight of 510.66 g/mol. Its IUPAC name is 4-[[(1R)-1-cyclobutylethyl]amino]-5-[[cyclohexyl(methyl)amino]methyl-[(4-fluorophenyl)methyl]amino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide.
| Compound Name | 4-[[(1R)-1-cyclobutylethyl]amino]-5-[[cyclohexyl(methyl)amino]methyl-[(4-fluorophenyl)methyl]amino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide |
|---|---|
| PubChem CID | 144677954 |
| Molecular Formula | C27H39FN8O |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | 4-[[(1R)-1-cyclobutylethyl]amino]-5-[[cyclohexyl(methyl)amino]methyl-[(4-fluorophenyl)methyl]amino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide |
| SMILES | C=Nc1nc(/C(N)=N/O)nc(N[C@H](C)C2CCC2)c1N(Cc1ccc(F)cc1)CN(C)C1CCCCC1 |
| InChI | InChI=1S/C27H39FN8O/c1-18(20-8-7-9-20)31-26-23(25(30-2)32-27(33-26)24(29)34-37)36(16-19-12-14-21(28)15-13-19)17-35(3)22-10-5-4-6-11-22/h12-15,18,20,22,37H,2,4-11,16-17H2,1,3H3,(H2,29,34)(H,31,32,33)/t18-/m1/s1 |
| InChIKey | UUAMNAOQFBILGI-GOSISDBHSA-N |
| XLogP | 4.87 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|