C22H40N8O2 — CID 144678116
4-[[(1R)-1-cyclobutylethyl]amino]-5-[cyclohexylmethyl(methylaminomethyl)amino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide;methanol (PubChem CID 144678116) has the molecular formula C22H40N8O2 and a molecular weight of 448.62 g/mol. Its IUPAC name is 4-[[(1R)-1-cyclobutylethyl]amino]-5-[cyclohexylmethyl(methylaminomethyl)amino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide;methanol.
| Compound Name | 4-[[(1R)-1-cyclobutylethyl]amino]-5-[cyclohexylmethyl(methylaminomethyl)amino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide;methanol |
|---|---|
| PubChem CID | 144678116 |
| Molecular Formula | C22H40N8O2 |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | 4-[[(1R)-1-cyclobutylethyl]amino]-5-[cyclohexylmethyl(methylaminomethyl)amino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide;methanol |
| SMILES | C=Nc1nc(/C(N)=N/O)nc(N[C@H](C)C2CCC2)c1N(CNC)CC1CCCCC1.CO |
| InChI | InChI=1S/C21H36N8O.CH4O/c1-14(16-10-7-11-16)25-20-17(19(24-3)26-21(27-20)18(22)28-30)29(13-23-2)12-15-8-5-4-6-9-15;1-2/h14-16,23,30H,3-13H2,1-2H3,(H2,22,28)(H,25,26,27);2H,1H3/t14-;/m1./s1 |
| InChIKey | XBXFUOHFOFWJHO-PFEQFJNWSA-N |
| XLogP | 2.68 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|