C19H32N8O — CID 137283620
4-[[(1R)-1-cyclobutylethyl]amino]-5-[[cyclopropylmethyl(methyl)amino]methyl-methylamino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide (PubChem CID 137283620) has the molecular formula C19H32N8O and a molecular weight of 388.52 g/mol. Its IUPAC name is 4-[[(1R)-1-cyclobutylethyl]amino]-5-[[cyclopropylmethyl(methyl)amino]methyl-methylamino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide.
| Compound Name | 4-[[(1R)-1-cyclobutylethyl]amino]-5-[[cyclopropylmethyl(methyl)amino]methyl-methylamino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide |
|---|---|
| PubChem CID | 137283620 |
| Molecular Formula | C19H32N8O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.27 |
| IUPAC Name | 4-[[(1R)-1-cyclobutylethyl]amino]-5-[[cyclopropylmethyl(methyl)amino]methyl-methylamino]-N'-hydroxy-6-(methylideneamino)pyrimidine-2-carboximidamide |
| SMILES | C=Nc1nc(/C(N)=N/O)nc(N[C@H](C)C2CCC2)c1N(C)CN(C)CC1CC1 |
| InChI | InChI=1S/C19H32N8O/c1-12(14-6-5-7-14)22-18-15(27(4)11-26(3)10-13-8-9-13)17(21-2)23-19(24-18)16(20)25-28/h12-14,28H,2,5-11H2,1,3-4H3,(H2,20,25)(H,22,23,24)/t12-/m1/s1 |
| InChIKey | LHOWYHFWKSOZQS-GFCCVEGCSA-N |
| XLogP | 2.24 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|