C28H43N7O3 — CID 123420581
[amino-[6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]-8-[1-(oxan-4-yl)ethyl]purin-2-yl]methylidene]carbamic acid (PubChem CID 123420581) has the molecular formula C28H43N7O3 and a molecular weight of 525.70 g/mol. Its IUPAC name is [amino-[6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]-8-[1-(oxan-4-yl)ethyl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]-8-[1-(oxan-4-yl)ethyl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123420581 |
| Molecular Formula | C28H43N7O3 |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.34 |
| IUPAC Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-methylcyclohexyl)methyl]-8-[1-(oxan-4-yl)ethyl]purin-2-yl]methylidene]carbamic acid |
| SMILES | CC1CCC(Cn2c(C(C)C3CCOCC3)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C28H43N7O3/c1-16-7-9-19(10-8-16)15-35-22-24(30-18(3)21-5-4-6-21)32-26(23(29)31-28(36)37)33-25(22)34-27(35)17(2)20-11-13-38-14-12-20/h16-21H,4-15H2,1-3H3,(H2,29,31)(H,36,37)(H,30,32,33) |
| InChIKey | BYAIOAJXDUKMDG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|