C26H39N7O2 — CID 134468693
(Z)-[amino-[6-[[(1R)-1-cyclobutylethyl]amino]-8-cyclopentyl-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid (PubChem CID 134468693) has the molecular formula C26H39N7O2 and a molecular weight of 481.65 g/mol. Its IUPAC name is (Z)-[amino-[6-[[(1R)-1-cyclobutylethyl]amino]-8-cyclopentyl-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[6-[[(1R)-1-cyclobutylethyl]amino]-8-cyclopentyl-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 134468693 |
| Molecular Formula | C26H39N7O2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | (Z)-[amino-[6-[[(1R)-1-cyclobutylethyl]amino]-8-cyclopentyl-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
| SMILES | CC1CCC(Cn2c(C3CCCC3)nc3nc(/C(N)=N/C(=O)O)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C26H39N7O2/c1-15-10-12-17(13-11-15)14-33-20-22(28-16(2)18-8-5-9-18)30-24(21(27)29-26(34)35)31-23(20)32-25(33)19-6-3-4-7-19/h15-19H,3-14H2,1-2H3,(H2,27,29)(H,34,35)(H,28,30,31)/t15?,16-,17?/m1/s1 |
| InChIKey | PBTIOGDRTALXGZ-AQFXKWCLSA-N |
| XLogP | 5.29 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|