C29H39N7O3 — CID 123413237
[amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-[1-(oxan-4-yl)ethenyl]purin-2-yl]methylidene]carbamic acid (PubChem CID 123413237) has the molecular formula C29H39N7O3 and a molecular weight of 533.68 g/mol. Its IUPAC name is [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-[1-(oxan-4-yl)ethenyl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-[1-(oxan-4-yl)ethenyl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123413237 |
| Molecular Formula | C29H39N7O3 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-[1-(oxan-4-yl)ethenyl]purin-2-yl]methylidene]carbamic acid |
| SMILES | C#CC1CCC(Cn2c(C(=C)C3CCOCC3)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C29H39N7O3/c1-4-19-8-10-20(11-9-19)16-36-23-25(31-18(3)22-6-5-7-22)33-27(24(30)32-29(37)38)34-26(23)35-28(36)17(2)21-12-14-39-15-13-21/h1,18-22H,2,5-16H2,3H3,(H2,30,32)(H,37,38)(H,31,33,34) |
| InChIKey | XOXSRJHDLBAMTP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|