C34H41N7O2 — CID 123422091
[amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-(2-phenylcyclohexen-1-yl)purin-2-yl]methylidene]carbamic acid (PubChem CID 123422091) has the molecular formula C34H41N7O2 and a molecular weight of 579.75 g/mol. Its IUPAC name is [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-(2-phenylcyclohexen-1-yl)purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-(2-phenylcyclohexen-1-yl)purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123422091 |
| Molecular Formula | C34H41N7O2 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | [amino-[6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]-8-(2-phenylcyclohexen-1-yl)purin-2-yl]methylidene]carbamic acid |
| SMILES | C#CC1CCC(Cn2c(C3=C(c4ccccc4)CCCC3)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C34H41N7O2/c1-3-22-16-18-23(19-17-22)20-41-28-30(36-21(2)24-12-9-13-24)38-32(29(35)37-34(42)43)39-31(28)40-33(41)27-15-8-7-14-26(27)25-10-5-4-6-11-25/h1,4-6,10-11,21-24H,7-9,12-20H2,2H3,(H2,35,37)(H,42,43)(H,36,38,39) |
| InChIKey | PTVOPYWVBLBQHS-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|