C26H37N7O2 — CID 123332415
[amino-[6-(1-cyclobutylethylamino)-8-(cyclopenten-1-yl)-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid (PubChem CID 123332415) has the molecular formula C26H37N7O2 and a molecular weight of 479.63 g/mol. Its IUPAC name is [amino-[6-(1-cyclobutylethylamino)-8-(cyclopenten-1-yl)-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(1-cyclobutylethylamino)-8-(cyclopenten-1-yl)-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123332415 |
| Molecular Formula | C26H37N7O2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | [amino-[6-(1-cyclobutylethylamino)-8-(cyclopenten-1-yl)-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
| SMILES | CC1CCC(Cn2c(C3=CCCC3)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C26H37N7O2/c1-15-10-12-17(13-11-15)14-33-20-22(28-16(2)18-8-5-9-18)30-24(21(27)29-26(34)35)31-23(20)32-25(33)19-6-3-4-7-19/h6,15-18H,3-5,7-14H2,1-2H3,(H2,27,29)(H,34,35)(H,28,30,31) |
| InChIKey | ZYIAGSNXGQXBGJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|