C13H21N7O2 — CID 134467634
carbamoyl 4-amino-6-[[(1R)-1-cyclobutylethyl]amino]-5-(methylamino)pyrimidine-2-carboximidate (PubChem CID 134467634) has the molecular formula C13H21N7O2 and a molecular weight of 307.36 g/mol. Its IUPAC name is carbamoyl 4-amino-6-[[(1R)-1-cyclobutylethyl]amino]-5-(methylamino)pyrimidine-2-carboximidate.
| Compound Name | carbamoyl 4-amino-6-[[(1R)-1-cyclobutylethyl]amino]-5-(methylamino)pyrimidine-2-carboximidate |
|---|---|
| PubChem CID | 134467634 |
| Molecular Formula | C13H21N7O2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | carbamoyl 4-amino-6-[[(1R)-1-cyclobutylethyl]amino]-5-(methylamino)pyrimidine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(N)c(NC)c(N[C@H](C)C2CCC2)n1 |
| InChI | InChI=1S/C13H21N7O2/c1-6(7-4-3-5-7)18-11-8(17-2)9(14)19-12(20-11)10(15)22-13(16)21/h6-7,15,17H,3-5H2,1-2H3,(H2,16,21)(H3,14,18,19,20)/b15-10-/t6-/m1/s1 |
| InChIKey | CFFWSKXTCMBQKF-CKIOPKJNSA-N |
| XLogP | 1.12 |
| TPSA | 152.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|