C10H18N4 — CID 103078915
3-N-(1-cyclobutylethyl)-1-methylpyrazole-3,4-diamine (PubChem CID 103078915) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-N-(1-cyclobutylethyl)-1-methylpyrazole-3,4-diamine.
| Compound Name | 3-N-(1-cyclobutylethyl)-1-methylpyrazole-3,4-diamine |
|---|---|
| PubChem CID | 103078915 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 3-N-(1-cyclobutylethyl)-1-methylpyrazole-3,4-diamine |
| SMILES | CC(Nc1nn(C)cc1N)C1CCC1 |
| InChI | InChI=1S/C10H18N4/c1-7(8-4-3-5-8)12-10-9(11)6-14(2)13-10/h6-8H,3-5,11H2,1-2H3,(H,12,13) |
| InChIKey | JUYZKDNISXNZBI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |