C10H18N4O — CID 103078379
3-N-(2-methoxycyclopentyl)-1-methylpyrazole-3,4-diamine (PubChem CID 103078379) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-N-(2-methoxycyclopentyl)-1-methylpyrazole-3,4-diamine.
| Compound Name | 3-N-(2-methoxycyclopentyl)-1-methylpyrazole-3,4-diamine |
|---|---|
| PubChem CID | 103078379 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-N-(2-methoxycyclopentyl)-1-methylpyrazole-3,4-diamine |
| SMILES | COC1CCCC1Nc1nn(C)cc1N |
| InChI | InChI=1S/C10H18N4O/c1-14-6-7(11)10(13-14)12-8-4-3-5-9(8)15-2/h6,8-9H,3-5,11H2,1-2H3,(H,12,13) |
| InChIKey | VDVNIBRTTOFQPD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |