C30H37ClN6O3 — CID 134468617
carbamoyl 6-(3-chlorophenyl)-8-[cyclohexyl(methoxy)methyl]-7-[(4-ethenylcyclohexyl)methyl]purine-2-carboximidate (PubChem CID 134468617) has the molecular formula C30H37ClN6O3 and a molecular weight of 565.12 g/mol. Its IUPAC name is carbamoyl 6-(3-chlorophenyl)-8-[cyclohexyl(methoxy)methyl]-7-[(4-ethenylcyclohexyl)methyl]purine-2-carboximidate.
| Compound Name | carbamoyl 6-(3-chlorophenyl)-8-[cyclohexyl(methoxy)methyl]-7-[(4-ethenylcyclohexyl)methyl]purine-2-carboximidate |
|---|---|
| PubChem CID | 134468617 |
| Molecular Formula | C30H37ClN6O3 |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | carbamoyl 6-(3-chlorophenyl)-8-[cyclohexyl(methoxy)methyl]-7-[(4-ethenylcyclohexyl)methyl]purine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(-c2cccc(Cl)c2)c2c(n1)nc(C(OC)C1CCCCC1)n2CC1CCC(C=C)CC1 |
| InChI | InChI=1S/C30H37ClN6O3/c1-3-18-12-14-19(15-13-18)17-37-24-23(21-10-7-11-22(31)16-21)34-28(26(32)40-30(33)38)35-27(24)36-29(37)25(39-2)20-8-5-4-6-9-20/h3,7,10-11,16,18-20,25,32H,1,4-6,8-9,12-15,17H2,2H3,(H2,33,38)/b32-26- |
| InChIKey | NEYUOCCNRNMSSY-FSRJSHLRSA-N |
| XLogP | 6.83 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|