C28H26ClF2N5O2 — CID 134468686
6-(5-chloro-3-pyridinyl)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-fluoro-1-(2-fluorophenyl)ethyl]purine-2-carboxylic acid (PubChem CID 134468686) has the molecular formula C28H26ClF2N5O2 and a molecular weight of 538.00 g/mol. Its IUPAC name is 6-(5-chloro-3-pyridinyl)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-fluoro-1-(2-fluorophenyl)ethyl]purine-2-carboxylic acid.
| Compound Name | 6-(5-chloro-3-pyridinyl)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-fluoro-1-(2-fluorophenyl)ethyl]purine-2-carboxylic acid |
|---|---|
| PubChem CID | 134468686 |
| Molecular Formula | C28H26ClF2N5O2 |
| Molecular Weight | 538.00 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 6-(5-chloro-3-pyridinyl)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-fluoro-1-(2-fluorophenyl)ethyl]purine-2-carboxylic acid |
| SMILES | C=CC1CCC(Cn2c(C(C)(F)c3ccccc3F)nc3nc(C(=O)O)nc(-c4cncc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C28H26ClF2N5O2/c1-3-16-8-10-17(11-9-16)15-36-23-22(18-12-19(29)14-32-13-18)33-25(26(37)38)34-24(23)35-27(36)28(2,31)20-6-4-5-7-21(20)30/h3-7,12-14,16-17H,1,8-11,15H2,2H3,(H,37,38) |
| InChIKey | RSERKWIBLQBBHC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.00 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|