C30H31ClFN7O2 — CID 123165077
[amino-[6-(3-chlorophenyl)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-(3-fluorophenyl)ethylamino]purin-2-yl]methylidene]carbamic acid (PubChem CID 123165077) has the molecular formula C30H31ClFN7O2 and a molecular weight of 576.08 g/mol. Its IUPAC name is [amino-[6-(3-chlorophenyl)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-(3-fluorophenyl)ethylamino]purin-2-yl]methylidene]carbamic acid.
| Compound Name | [amino-[6-(3-chlorophenyl)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-(3-fluorophenyl)ethylamino]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 123165077 |
| Molecular Formula | C30H31ClFN7O2 |
| Molecular Weight | 576.08 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | [amino-[6-(3-chlorophenyl)-7-[(4-ethenylcyclohexyl)methyl]-8-[1-(3-fluorophenyl)ethylamino]purin-2-yl]methylidene]carbamic acid |
| SMILES | C=CC1CCC(Cn2c(NC(C)c3cccc(F)c3)nc3nc(C(N)=NC(=O)O)nc(-c4cccc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C30H31ClFN7O2/c1-3-18-10-12-19(13-11-18)16-39-25-24(21-7-4-8-22(31)14-21)35-28(26(33)36-30(40)41)37-27(25)38-29(39)34-17(2)20-6-5-9-23(32)15-20/h3-9,14-15,17-19H,1,10-13,16H2,2H3,(H2,33,36)(H,40,41)(H,34,35,37,38) |
| InChIKey | RZGUMMRJKJFNCB-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.08 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|