C27H33ClN8O3 — CID 134468558
(Z)-[amino-[6-(3-chlorophenyl)-8-[(2R)-2,4-dimethyl-5-oxopiperazin-1-yl]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid (PubChem CID 134468558) has the molecular formula C27H33ClN8O3 and a molecular weight of 553.07 g/mol. Its IUPAC name is (Z)-[amino-[6-(3-chlorophenyl)-8-[(2R)-2,4-dimethyl-5-oxopiperazin-1-yl]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[6-(3-chlorophenyl)-8-[(2R)-2,4-dimethyl-5-oxopiperazin-1-yl]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 134468558 |
| Molecular Formula | C27H33ClN8O3 |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | (Z)-[amino-[6-(3-chlorophenyl)-8-[(2R)-2,4-dimethyl-5-oxopiperazin-1-yl]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]methylidene]carbamic acid |
| SMILES | CC1CCC(Cn2c(N3CC(=O)N(C)C[C@H]3C)nc3nc(/C(N)=N/C(=O)O)nc(-c4cccc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C27H33ClN8O3/c1-15-7-9-17(10-8-15)13-36-22-21(18-5-4-6-19(28)11-18)30-25(23(29)31-27(38)39)32-24(22)33-26(36)35-14-20(37)34(3)12-16(35)2/h4-6,11,15-17H,7-10,12-14H2,1-3H3,(H2,29,31)(H,38,39)/t15?,16-,17?/m1/s1 |
| InChIKey | GECRKVXIZRTEOO-AQFXKWCLSA-N |
| XLogP | 4.02 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|