C30H36IN7O2 — CID 136632769
N'-hydroxy-8-[[(1R,2S)-2-hydroxy-1-phenylpropyl]amino]-6-[3-(iodomethyl)phenyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidamide (PubChem CID 136632769) has the molecular formula C30H36IN7O2 and a molecular weight of 653.57 g/mol. Its IUPAC name is N'-hydroxy-8-[[(1R,2S)-2-hydroxy-1-phenylpropyl]amino]-6-[3-(iodomethyl)phenyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidamide.
| Compound Name | N'-hydroxy-8-[[(1R,2S)-2-hydroxy-1-phenylpropyl]amino]-6-[3-(iodomethyl)phenyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidamide |
|---|---|
| PubChem CID | 136632769 |
| Molecular Formula | C30H36IN7O2 |
| Molecular Weight | 653.57 g/mol |
| Exact Mass | 653.20 |
| IUPAC Name | N'-hydroxy-8-[[(1R,2S)-2-hydroxy-1-phenylpropyl]amino]-6-[3-(iodomethyl)phenyl]-7-[(4-methylcyclohexyl)methyl]purine-2-carboximidamide |
| SMILES | CC1CCC(Cn2c(N[C@H](c3ccccc3)[C@H](C)O)nc3nc(/C(N)=N/O)nc(-c4cccc(CI)c4)c32)CC1 |
| InChI | InChI=1S/C30H36IN7O2/c1-18-11-13-20(14-12-18)17-38-26-25(23-10-6-7-21(15-23)16-31)33-29(27(32)37-40)35-28(26)36-30(38)34-24(19(2)39)22-8-4-3-5-9-22/h3-10,15,18-20,24,39-40H,11-14,16-17H2,1-2H3,(H2,32,37)(H,33,34,35,36)/t18?,19-,20?,24-/m0/s1 |
| InChIKey | PLIDRNKWGHZXEY-DRMKDWESSA-N |
| XLogP | 5.88 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|