C31H40ClN7O2 — CID 144678204
N-[amino-[6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]-8-(propylamino)purin-2-yl]methylidene]formamide;benzene;methanol (PubChem CID 144678204) has the molecular formula C31H40ClN7O2 and a molecular weight of 578.16 g/mol. Its IUPAC name is N-[amino-[6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]-8-(propylamino)purin-2-yl]methylidene]formamide;benzene;methanol.
| Compound Name | N-[amino-[6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]-8-(propylamino)purin-2-yl]methylidene]formamide;benzene;methanol |
|---|---|
| PubChem CID | 144678204 |
| Molecular Formula | C31H40ClN7O2 |
| Molecular Weight | 578.16 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | N-[amino-[6-(3-chlorophenyl)-7-[(4-methylcyclohexyl)methyl]-8-(propylamino)purin-2-yl]methylidene]formamide;benzene;methanol |
| SMILES | CCCNc1nc2nc(/C(N)=N/C=O)nc(-c3cccc(Cl)c3)c2n1CC1CCC(C)CC1.CO.c1ccccc1 |
| InChI | InChI=1S/C24H30ClN7O.C6H6.CH4O/c1-3-11-27-24-31-22-20(32(24)13-16-9-7-15(2)8-10-16)19(17-5-4-6-18(25)12-17)29-23(30-22)21(26)28-14-33;1-2-4-6-5-3-1;1-2/h4-6,12,14-16H,3,7-11,13H2,1-2H3,(H2,26,28,33)(H,27,29,30,31);1-6H;2H,1H3 |
| InChIKey | ULZJXVBQSDXOBY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.16 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|