C23H27ClN8O2 — CID 134468300
6-(3-chlorophenyl)-7-(cyclohexylmethyl)-8-morpholin-4-yl-N'-nitrosopurine-2-carboximidamide (PubChem CID 134468300) has the molecular formula C23H27ClN8O2 and a molecular weight of 482.98 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-7-(cyclohexylmethyl)-8-morpholin-4-yl-N'-nitrosopurine-2-carboximidamide.
| Compound Name | 6-(3-chlorophenyl)-7-(cyclohexylmethyl)-8-morpholin-4-yl-N'-nitrosopurine-2-carboximidamide |
|---|---|
| PubChem CID | 134468300 |
| Molecular Formula | C23H27ClN8O2 |
| Molecular Weight | 482.98 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 6-(3-chlorophenyl)-7-(cyclohexylmethyl)-8-morpholin-4-yl-N'-nitrosopurine-2-carboximidamide |
| SMILES | NC(=NN=O)c1nc(-c2cccc(Cl)c2)c2c(n1)nc(N1CCOCC1)n2CC1CCCCC1 |
| InChI | InChI=1S/C23H27ClN8O2/c24-17-8-4-7-16(13-17)18-19-21(27-22(26-18)20(25)29-30-33)28-23(31-9-11-34-12-10-31)32(19)14-15-5-2-1-3-6-15/h4,7-8,13,15H,1-3,5-6,9-12,14H2,(H2,25,29,33) |
| InChIKey | KSNFCUHJAASWOD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.98 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|