C27H37N7O2 — CID 123920009
N'-(hydroxymethyl)-7-[(4-methylcyclohexyl)methyl]-8-(3-methylmorpholin-4-yl)-6-(3-methylphenyl)purine-2-carboximidamide (PubChem CID 123920009) has the molecular formula C27H37N7O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is N'-(hydroxymethyl)-7-[(4-methylcyclohexyl)methyl]-8-(3-methylmorpholin-4-yl)-6-(3-methylphenyl)purine-2-carboximidamide.
| Compound Name | N'-(hydroxymethyl)-7-[(4-methylcyclohexyl)methyl]-8-(3-methylmorpholin-4-yl)-6-(3-methylphenyl)purine-2-carboximidamide |
|---|---|
| PubChem CID | 123920009 |
| Molecular Formula | C27H37N7O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | N'-(hydroxymethyl)-7-[(4-methylcyclohexyl)methyl]-8-(3-methylmorpholin-4-yl)-6-(3-methylphenyl)purine-2-carboximidamide |
| SMILES | Cc1cccc(-c2nc(C(N)=NCO)nc3nc(N4CCOCC4C)n(CC4CCC(C)CC4)c23)c1 |
| InChI | InChI=1S/C27H37N7O2/c1-17-7-9-20(10-8-17)14-34-23-22(21-6-4-5-18(2)13-21)30-26(24(28)29-16-35)31-25(23)32-27(34)33-11-12-36-15-19(33)3/h4-6,13,17,19-20,35H,7-12,14-16H2,1-3H3,(H2,28,29) |
| InChIKey | VBNVNDYUCQXDNO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|