C30H36ClN7O3 — CID 137161973
3-[8-(2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-1-yl)-6-(3-chlorophenyl)-7-[(4-ethylcyclohexyl)methyl]purin-2-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 137161973) has the molecular formula C30H36ClN7O3 and a molecular weight of 578.12 g/mol. Its IUPAC name is 3-[8-(2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-1-yl)-6-(3-chlorophenyl)-7-[(4-ethylcyclohexyl)methyl]purin-2-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[8-(2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-1-yl)-6-(3-chlorophenyl)-7-[(4-ethylcyclohexyl)methyl]purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 137161973 |
| Molecular Formula | C30H36ClN7O3 |
| Molecular Weight | 578.12 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 3-[8-(2,3,4,4a,5,7,8,8a-octahydropyrano[4,3-b]pyridin-1-yl)-6-(3-chlorophenyl)-7-[(4-ethylcyclohexyl)methyl]purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCC1CCC(Cn2c(N3CCCC4COCCC43)nc3nc(-c4noc(=O)[nH]4)nc(-c4cccc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C30H36ClN7O3/c1-2-18-8-10-19(11-9-18)16-38-25-24(20-5-3-7-22(31)15-20)32-27(28-35-30(39)41-36-28)33-26(25)34-29(38)37-13-4-6-21-17-40-14-12-23(21)37/h3,5,7,15,18-19,21,23H,2,4,6,8-14,16-17H2,1H3,(H,35,36,39) |
| InChIKey | UCRUIXRKPVVORA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.12 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |