C29H33F3N8O3 — CID 137283773
3-[7-[(4-ethenylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]purin-2-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 137283773) has the molecular formula C29H33F3N8O3 and a molecular weight of 598.63 g/mol. Its IUPAC name is 3-[7-[(4-ethenylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]purin-2-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[7-[(4-ethenylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 137283773 |
| Molecular Formula | C29H33F3N8O3 |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 3-[7-[(4-ethenylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]-6-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | C=CC1CCC(Cn2c(N3CCOC[C@H]3c3ccccc3)nc3nc(-c4noc(=O)[nH]4)nc(N[C@H](C)C(F)(F)F)c32)CC1 |
| InChI | InChI=1S/C29H33F3N8O3/c1-3-18-9-11-19(12-10-18)15-40-22-23(33-17(2)29(30,31)32)34-25(26-37-28(41)43-38-26)35-24(22)36-27(40)39-13-14-42-16-21(39)20-7-5-4-6-8-20/h3-8,17-19,21H,1,9-16H2,2H3,(H,33,34,35)(H,37,38,41)/t17-,18?,19?,21+/m1/s1 |
| InChIKey | QMDTYRPIZYKQPW-HZGZPEGRSA-N |
| XLogP | 5.10 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|