C25H23Cl3FN5 — CID 90317629
2-chloro-8-[chloro-(2-fluorophenyl)methyl]-6-(5-chloro-3-pyridinyl)-7-[(4-methylcyclohexyl)methyl]purine (PubChem CID 90317629) has the molecular formula C25H23Cl3FN5 and a molecular weight of 518.85 g/mol. Its IUPAC name is 2-chloro-8-[chloro-(2-fluorophenyl)methyl]-6-(5-chloro-3-pyridinyl)-7-[(4-methylcyclohexyl)methyl]purine.
| Compound Name | 2-chloro-8-[chloro-(2-fluorophenyl)methyl]-6-(5-chloro-3-pyridinyl)-7-[(4-methylcyclohexyl)methyl]purine |
|---|---|
| PubChem CID | 90317629 |
| Molecular Formula | C25H23Cl3FN5 |
| Molecular Weight | 518.85 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 2-chloro-8-[chloro-(2-fluorophenyl)methyl]-6-(5-chloro-3-pyridinyl)-7-[(4-methylcyclohexyl)methyl]purine |
| SMILES | CC1CCC(Cn2c(C(Cl)c3ccccc3F)nc3nc(Cl)nc(-c4cncc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C25H23Cl3FN5/c1-14-6-8-15(9-7-14)13-34-22-21(16-10-17(26)12-30-11-16)31-25(28)33-23(22)32-24(34)20(27)18-4-2-3-5-19(18)29/h2-5,10-12,14-15,20H,6-9,13H2,1H3 |
| InChIKey | KRTFVONRZLMFIE-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.85 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|