C19H23ClN6O2 — CID 134468322
carbamoyl 4-amino-6-(3-chlorophenyl)-5-(cyclohexylmethylamino)pyrimidine-2-carboximidate (PubChem CID 134468322) has the molecular formula C19H23ClN6O2 and a molecular weight of 402.89 g/mol. Its IUPAC name is carbamoyl 4-amino-6-(3-chlorophenyl)-5-(cyclohexylmethylamino)pyrimidine-2-carboximidate.
| Compound Name | carbamoyl 4-amino-6-(3-chlorophenyl)-5-(cyclohexylmethylamino)pyrimidine-2-carboximidate |
|---|---|
| PubChem CID | 134468322 |
| Molecular Formula | C19H23ClN6O2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | carbamoyl 4-amino-6-(3-chlorophenyl)-5-(cyclohexylmethylamino)pyrimidine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(N)c(NCC2CCCCC2)c(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C19H23ClN6O2/c20-13-8-4-7-12(9-13)14-15(24-10-11-5-2-1-3-6-11)16(21)26-18(25-14)17(22)28-19(23)27/h4,7-9,11,22,24H,1-3,5-6,10H2,(H2,23,27)(H2,21,25,26)/b22-17- |
| InChIKey | SCDUGOIEXATDIR-XLNRJJMWSA-N |
| XLogP | 3.79 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|