C25H32ClN8O3P — CID 144678029
carbamoyl 4-amino-6-(5-chloro-3-pyridinyl)-5-[[(6S,9R)-9-methyl-5-phosphanyl-1,3,4,4a,6,7,8,9,10,10a-decahydropyrano[4,3-b]quinolin-6-yl]methylamino]pyrimidine-2-carboximidate (PubChem CID 144678029) has the molecular formula C25H32ClN8O3P and a molecular weight of 559.01 g/mol. Its IUPAC name is carbamoyl 4-amino-6-(5-chloro-3-pyridinyl)-5-[[(6S,9R)-9-methyl-5-phosphanyl-1,3,4,4a,6,7,8,9,10,10a-decahydropyrano[4,3-b]quinolin-6-yl]methylamino]pyrimidine-2-carboximidate.
| Compound Name | carbamoyl 4-amino-6-(5-chloro-3-pyridinyl)-5-[[(6S,9R)-9-methyl-5-phosphanyl-1,3,4,4a,6,7,8,9,10,10a-decahydropyrano[4,3-b]quinolin-6-yl]methylamino]pyrimidine-2-carboximidate |
|---|---|
| PubChem CID | 144678029 |
| Molecular Formula | C25H32ClN8O3P |
| Molecular Weight | 559.01 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | carbamoyl 4-amino-6-(5-chloro-3-pyridinyl)-5-[[(6S,9R)-9-methyl-5-phosphanyl-1,3,4,4a,6,7,8,9,10,10a-decahydropyrano[4,3-b]quinolin-6-yl]methylamino]pyrimidine-2-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(N)c(NC[C@@H]2CC[C@@H](C)C3=C2N(P)C2CCOCC2C3)c(-c2cncc(Cl)c2)n1 |
| InChI | InChI=1S/C25H32ClN8O3P/c1-12-2-3-13(21-17(12)7-15-11-36-5-4-18(15)34(21)38)9-31-20-19(14-6-16(26)10-30-8-14)32-24(33-22(20)27)23(28)37-25(29)35/h6,8,10,12-13,15,18,28,31H,2-5,7,9,11,38H2,1H3,(H2,29,35)(H2,27,32,33)/b28-23-/t12-,13+,15?,18?/m1/s1 |
| InChIKey | NQIQBQYAUFNHHO-JTZJFLQUSA-N |
| XLogP | 3.81 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|