C28H25ClN8O3 — CID 134468469
carbamoyl (15R,19R)-8-(5-chloro-3-pyridinyl)-15-methyl-19-phenyl-17-oxa-1,3,5,7,10-pentazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4,6,8,16(20)-pentaene-6-carboximidate (PubChem CID 134468469) has the molecular formula C28H25ClN8O3 and a molecular weight of 557.01 g/mol. Its IUPAC name is carbamoyl (15R,19R)-8-(5-chloro-3-pyridinyl)-15-methyl-19-phenyl-17-oxa-1,3,5,7,10-pentazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4,6,8,16(20)-pentaene-6-carboximidate.
| Compound Name | carbamoyl (15R,19R)-8-(5-chloro-3-pyridinyl)-15-methyl-19-phenyl-17-oxa-1,3,5,7,10-pentazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4,6,8,16(20)-pentaene-6-carboximidate |
|---|---|
| PubChem CID | 134468469 |
| Molecular Formula | C28H25ClN8O3 |
| Molecular Weight | 557.01 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | carbamoyl (15R,19R)-8-(5-chloro-3-pyridinyl)-15-methyl-19-phenyl-17-oxa-1,3,5,7,10-pentazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4,6,8,16(20)-pentaene-6-carboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1nc(-c2cncc(Cl)c2)c2c(n1)nc1n2CC2CC[C@@H](C)C3=C2N1[C@H](c1ccccc1)CO3 |
| InChI | InChI=1S/C28H25ClN8O3/c1-14-7-8-16-12-36-22-20(17-9-18(29)11-32-10-17)33-26(24(30)40-27(31)38)34-25(22)35-28(36)37-19(13-39-23(14)21(16)37)15-5-3-2-4-6-15/h2-6,9-11,14,16,19,30H,7-8,12-13H2,1H3,(H2,31,38)/b30-24-/t14-,16?,19+/m1/s1 |
| InChIKey | BEPCOAHILYXDMG-APDQSWPKSA-N |
| XLogP | 4.81 |
| TPSA | 145.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.01 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|