C23H23ClN8O3 — CID 144678349
(Z)-[amino-[(12S,15R,18R)-8-(5-chloro-3-pyridinyl)-15,18-dimethyl-17-oxa-1,3,5,7,10-pentazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4,6,8,16(20)-pentaen-6-yl]methylidene]carbamic acid (PubChem CID 144678349) has the molecular formula C23H23ClN8O3 and a molecular weight of 494.94 g/mol. Its IUPAC name is (Z)-[amino-[(12S,15R,18R)-8-(5-chloro-3-pyridinyl)-15,18-dimethyl-17-oxa-1,3,5,7,10-pentazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4,6,8,16(20)-pentaen-6-yl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[(12S,15R,18R)-8-(5-chloro-3-pyridinyl)-15,18-dimethyl-17-oxa-1,3,5,7,10-pentazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4,6,8,16(20)-pentaen-6-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 144678349 |
| Molecular Formula | C23H23ClN8O3 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | (Z)-[amino-[(12S,15R,18R)-8-(5-chloro-3-pyridinyl)-15,18-dimethyl-17-oxa-1,3,5,7,10-pentazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-2,4,6,8,16(20)-pentaen-6-yl]methylidene]carbamic acid |
| SMILES | C[C@@H]1CN2C3=C(O1)[C@H](C)CC[C@H]3Cn1c2nc2nc(/C(N)=N/C(=O)O)nc(-c3cncc(Cl)c3)c21 |
| InChI | InChI=1S/C23H23ClN8O3/c1-10-3-4-12-9-32-17-15(13-5-14(24)7-26-6-13)27-21(19(25)28-23(33)34)29-20(17)30-22(32)31-8-11(2)35-18(10)16(12)31/h5-7,10-12H,3-4,8-9H2,1-2H3,(H2,25,28)(H,33,34)/t10-,11-,12+/m1/s1 |
| InChIKey | OKDDKONIPWJGHK-UTUOFQBUSA-N |
| XLogP | 3.42 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|