C31H36ClN7O5 — CID 144678439
(Z)-[amino-[4-amino-6-(5-chloro-3-pyridinyl)-5-[(6-ethenylspiro[2.5]octan-2-yl)-[1-methoxy-1-(2-methoxyphenyl)ethoxy]amino]pyrimidin-2-yl]methylidene]carbamic acid (PubChem CID 144678439) has the molecular formula C31H36ClN7O5 and a molecular weight of 622.13 g/mol. Its IUPAC name is (Z)-[amino-[4-amino-6-(5-chloro-3-pyridinyl)-5-[(6-ethenylspiro[2.5]octan-2-yl)-[1-methoxy-1-(2-methoxyphenyl)ethoxy]amino]pyrimidin-2-yl]methylidene]carbamic acid.
| Compound Name | (Z)-[amino-[4-amino-6-(5-chloro-3-pyridinyl)-5-[(6-ethenylspiro[2.5]octan-2-yl)-[1-methoxy-1-(2-methoxyphenyl)ethoxy]amino]pyrimidin-2-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 144678439 |
| Molecular Formula | C31H36ClN7O5 |
| Molecular Weight | 622.13 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | (Z)-[amino-[4-amino-6-(5-chloro-3-pyridinyl)-5-[(6-ethenylspiro[2.5]octan-2-yl)-[1-methoxy-1-(2-methoxyphenyl)ethoxy]amino]pyrimidin-2-yl]methylidene]carbamic acid |
| SMILES | C=CC1CCC2(CC1)CC2N(OC(C)(OC)c1ccccc1OC)c1c(N)nc(/C(N)=N/C(=O)O)nc1-c1cncc(Cl)c1 |
| InChI | InChI=1S/C31H36ClN7O5/c1-5-18-10-12-31(13-11-18)15-23(31)39(44-30(2,43-4)21-8-6-7-9-22(21)42-3)25-24(19-14-20(32)17-35-16-19)36-28(37-26(25)33)27(34)38-29(40)41/h5-9,14,16-18,23H,1,10-13,15H2,2-4H3,(H2,34,38)(H,40,41)(H2,33,36,37) |
| InChIKey | AMABGAQYMLKZPZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 171.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.13 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|