C26H34ClN7O3 — CID 152771761
4-(5-chloro-3-pyridinyl)-N'-hydroxy-2-[[(3R,4S)-4-methoxyoxolan-3-yl]-methylamino]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridine-6-carboximidamide (PubChem CID 152771761) has the molecular formula C26H34ClN7O3 and a molecular weight of 528.06 g/mol. Its IUPAC name is 4-(5-chloro-3-pyridinyl)-N'-hydroxy-2-[[(3R,4S)-4-methoxyoxolan-3-yl]-methylamino]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridine-6-carboximidamide.
| Compound Name | 4-(5-chloro-3-pyridinyl)-N'-hydroxy-2-[[(3R,4S)-4-methoxyoxolan-3-yl]-methylamino]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridine-6-carboximidamide |
|---|---|
| PubChem CID | 152771761 |
| Molecular Formula | C26H34ClN7O3 |
| Molecular Weight | 528.06 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 4-(5-chloro-3-pyridinyl)-N'-hydroxy-2-[[(3R,4S)-4-methoxyoxolan-3-yl]-methylamino]-3-[(4-methylcyclohexyl)methyl]imidazo[4,5-c]pyridine-6-carboximidamide |
| SMILES | CO[C@@H]1COC[C@H]1N(C)c1nc2cc(C(N)=NO)nc(-c3cncc(Cl)c3)c2n1CC1CCC(C)CC1 |
| InChI | InChI=1S/C26H34ClN7O3/c1-15-4-6-16(7-5-15)12-34-24-19(31-26(34)33(2)21-13-37-14-22(21)36-3)9-20(25(28)32-35)30-23(24)17-8-18(27)11-29-10-17/h8-11,15-16,21-22,35H,4-7,12-14H2,1-3H3,(H2,28,32)/t15?,16?,21-,22-/m1/s1 |
| InChIKey | RMEUNQTXOSSTBJ-KFDDOUNDSA-N |
| XLogP | 3.92 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.06 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|