C27H35ClN6O2 — CID 144652437
4-(5-chloro-3-pyridinyl)-3-(cyclohexylmethyl)-2-[cyclopentyl(ethoxy)methyl]-N'-hydroxyimidazo[4,5-c]pyridine-6-carboximidamide (PubChem CID 144652437) has the molecular formula C27H35ClN6O2 and a molecular weight of 511.07 g/mol. Its IUPAC name is 4-(5-chloro-3-pyridinyl)-3-(cyclohexylmethyl)-2-[cyclopentyl(ethoxy)methyl]-N'-hydroxyimidazo[4,5-c]pyridine-6-carboximidamide.
| Compound Name | 4-(5-chloro-3-pyridinyl)-3-(cyclohexylmethyl)-2-[cyclopentyl(ethoxy)methyl]-N'-hydroxyimidazo[4,5-c]pyridine-6-carboximidamide |
|---|---|
| PubChem CID | 144652437 |
| Molecular Formula | C27H35ClN6O2 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 4-(5-chloro-3-pyridinyl)-3-(cyclohexylmethyl)-2-[cyclopentyl(ethoxy)methyl]-N'-hydroxyimidazo[4,5-c]pyridine-6-carboximidamide |
| SMILES | CCOC(c1nc2cc(/C(N)=N/O)nc(-c3cncc(Cl)c3)c2n1CC1CCCCC1)C1CCCC1 |
| InChI | InChI=1S/C27H35ClN6O2/c1-2-36-25(18-10-6-7-11-18)27-32-21-13-22(26(29)33-35)31-23(19-12-20(28)15-30-14-19)24(21)34(27)16-17-8-4-3-5-9-17/h12-15,17-18,25,35H,2-11,16H2,1H3,(H2,29,33) |
| InChIKey | TXLFPBZHOZGLRL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|