C16H20ClN3 — CID 63525557
4-(3-chlorophenyl)-5-cycloheptyl-1H-pyrazol-3-amine (PubChem CID 63525557) has the molecular formula C16H20ClN3 and a molecular weight of 289.81 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-cycloheptyl-1H-pyrazol-3-amine.
| Compound Name | 4-(3-chlorophenyl)-5-cycloheptyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 63525557 |
| Molecular Formula | C16H20ClN3 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-(3-chlorophenyl)-5-cycloheptyl-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(C2CCCCCC2)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H20ClN3/c17-13-9-5-8-12(10-13)14-15(19-20-16(14)18)11-6-3-1-2-4-7-11/h5,8-11H,1-4,6-7H2,(H3,18,19,20) |
| InChIKey | OMESLICRGDCHJX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |